C28H26NO4P — CID 15183613
benzyl N-[phenyl-[phenyl(phenylmethoxy)phosphoryl]methyl]carbamate (PubChem CID 15183613) has the molecular formula C28H26NO4P and a molecular weight of 471.49 g/mol. Its IUPAC name is benzyl N-[phenyl-[phenyl(phenylmethoxy)phosphoryl]methyl]carbamate.
| Compound Name | benzyl N-[phenyl-[phenyl(phenylmethoxy)phosphoryl]methyl]carbamate |
|---|---|
| PubChem CID | 15183613 |
| Molecular Formula | C28H26NO4P |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | benzyl N-[phenyl-[phenyl(phenylmethoxy)phosphoryl]methyl]carbamate |
| SMILES | O=C(NC(c1ccccc1)P(=O)(OCc1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H26NO4P/c30-28(32-21-23-13-5-1-6-14-23)29-27(25-17-9-3-10-18-25)34(31,26-19-11-4-12-20-26)33-22-24-15-7-2-8-16-24/h1-20,27H,21-22H2,(H,29,30) |
| InChIKey | RUHYGHBLBVSTBL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|