C24H27N2O6PS — CID 135065884
phenyl-[phenyl-[[(2S)-2-(phenylmethoxycarbonylamino)propyl]sulfonylamino]methyl]phosphinic acid (PubChem CID 135065884) has the molecular formula C24H27N2O6PS and a molecular weight of 502.53 g/mol. Its IUPAC name is phenyl-[phenyl-[[(2S)-2-(phenylmethoxycarbonylamino)propyl]sulfonylamino]methyl]phosphinic acid.
| Compound Name | phenyl-[phenyl-[[(2S)-2-(phenylmethoxycarbonylamino)propyl]sulfonylamino]methyl]phosphinic acid |
|---|---|
| PubChem CID | 135065884 |
| Molecular Formula | C24H27N2O6PS |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | phenyl-[phenyl-[[(2S)-2-(phenylmethoxycarbonylamino)propyl]sulfonylamino]methyl]phosphinic acid |
| SMILES | C[C@@H](CS(=O)(=O)NC(c1ccccc1)P(=O)(O)c1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H27N2O6PS/c1-19(25-24(27)32-17-20-11-5-2-6-12-20)18-34(30,31)26-23(21-13-7-3-8-14-21)33(28,29)22-15-9-4-10-16-22/h2-16,19,23,26H,17-18H2,1H3,(H,25,27)(H,28,29)/t19-,23?/m0/s1 |
| InChIKey | IQQKAFKTTUBILT-HSTJUUNISA-N |
| XLogP | 3.52 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|