C13H19N2O6P — CID 23506654
[4-amino-3-oxo-1-(phenylmethoxycarbonylamino)pentyl]phosphonic acid (PubChem CID 23506654) has the molecular formula C13H19N2O6P and a molecular weight of 330.28 g/mol. Its IUPAC name is [4-amino-3-oxo-1-(phenylmethoxycarbonylamino)pentyl]phosphonic acid.
| Compound Name | [4-amino-3-oxo-1-(phenylmethoxycarbonylamino)pentyl]phosphonic acid |
|---|---|
| PubChem CID | 23506654 |
| Molecular Formula | C13H19N2O6P |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [4-amino-3-oxo-1-(phenylmethoxycarbonylamino)pentyl]phosphonic acid |
| SMILES | CC(N)C(=O)CC(NC(=O)OCc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C13H19N2O6P/c1-9(14)11(16)7-12(22(18,19)20)15-13(17)21-8-10-5-3-2-4-6-10/h2-6,9,12H,7-8,14H2,1H3,(H,15,17)(H2,18,19,20) |
| InChIKey | DAFKEOBBIZGMFW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|