C18H22NO5P — CID 172774229
benzyl N-[dimethoxyphosphoryl-(3-methylphenyl)methyl]carbamate (PubChem CID 172774229) has the molecular formula C18H22NO5P and a molecular weight of 363.35 g/mol. Its IUPAC name is benzyl N-[dimethoxyphosphoryl-(3-methylphenyl)methyl]carbamate.
| Compound Name | benzyl N-[dimethoxyphosphoryl-(3-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 172774229 |
| Molecular Formula | C18H22NO5P |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | benzyl N-[dimethoxyphosphoryl-(3-methylphenyl)methyl]carbamate |
| SMILES | COP(=O)(OC)C(NC(=O)OCc1ccccc1)c1cccc(C)c1 |
| InChI | InChI=1S/C18H22NO5P/c1-14-8-7-11-16(12-14)17(25(21,22-2)23-3)19-18(20)24-13-15-9-5-4-6-10-15/h4-12,17H,13H2,1-3H3,(H,19,20) |
| InChIKey | NJCIWQWDGZFACM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|