C28H27N4O5P — CID 11204493
benzyl N-[[3-(diaminomethylideneamino)phenyl]-diphenoxyphosphorylmethyl]carbamate (PubChem CID 11204493) has the molecular formula C28H27N4O5P and a molecular weight of 530.52 g/mol. Its IUPAC name is benzyl N-[[3-(diaminomethylideneamino)phenyl]-diphenoxyphosphorylmethyl]carbamate.
| Compound Name | benzyl N-[[3-(diaminomethylideneamino)phenyl]-diphenoxyphosphorylmethyl]carbamate |
|---|---|
| PubChem CID | 11204493 |
| Molecular Formula | C28H27N4O5P |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | benzyl N-[[3-(diaminomethylideneamino)phenyl]-diphenoxyphosphorylmethyl]carbamate |
| SMILES | NC(N)=Nc1cccc(C(NC(=O)OCc2ccccc2)P(=O)(Oc2ccccc2)Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H27N4O5P/c29-27(30)31-23-14-10-13-22(19-23)26(32-28(33)35-20-21-11-4-1-5-12-21)38(34,36-24-15-6-2-7-16-24)37-25-17-8-3-9-18-25/h1-19,26H,20H2,(H,32,33)(H4,29,30,31) |
| InChIKey | YMGSNADWJKWFEJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|