C24H27N4O5PS — CID 118405528
2-methylsulfanylethyl N-[[4-(diaminomethylideneamino)phenyl]-diphenoxyphosphorylmethyl]carbamate (PubChem CID 118405528) has the molecular formula C24H27N4O5PS and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-methylsulfanylethyl N-[[4-(diaminomethylideneamino)phenyl]-diphenoxyphosphorylmethyl]carbamate.
| Compound Name | 2-methylsulfanylethyl N-[[4-(diaminomethylideneamino)phenyl]-diphenoxyphosphorylmethyl]carbamate |
|---|---|
| PubChem CID | 118405528 |
| Molecular Formula | C24H27N4O5PS |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-methylsulfanylethyl N-[[4-(diaminomethylideneamino)phenyl]-diphenoxyphosphorylmethyl]carbamate |
| SMILES | CSCCOC(=O)NC(c1ccc(N=C(N)N)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C24H27N4O5PS/c1-35-17-16-31-24(29)28-22(18-12-14-19(15-13-18)27-23(25)26)34(30,32-20-8-4-2-5-9-20)33-21-10-6-3-7-11-21/h2-15,22H,16-17H2,1H3,(H,28,29)(H4,25,26,27) |
| InChIKey | IJYQOSWGXGAHQV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|