C31H37N4O8P — CID 89158181
2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate (PubChem CID 89158181) has the molecular formula C31H37N4O8P and a molecular weight of 624.63 g/mol. Its IUPAC name is 2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate.
| Compound Name | 2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate |
|---|---|
| PubChem CID | 89158181 |
| Molecular Formula | C31H37N4O8P |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl N-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]carbamate |
| SMILES | C#CCOCCOCCOCCOC(=O)NC(Cc1ccc(N=C(N)N)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C31H37N4O8P/c1-2-17-38-18-19-39-20-21-40-22-23-41-31(36)35-29(24-25-13-15-26(16-14-25)34-30(32)33)44(37,42-27-9-5-3-6-10-27)43-28-11-7-4-8-12-28/h1,3-16,29H,17-24H2,(H,35,36)(H4,32,33,34) |
| InChIKey | NNWSCHSMIAUJHJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 165.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|