C29H28F3N4O8P — CID 90006453
[[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]-(2-prop-2-ynoxyethoxycarbonyl)amino] 2,2,2-trifluoroacetate (PubChem CID 90006453) has the molecular formula C29H28F3N4O8P and a molecular weight of 648.53 g/mol. Its IUPAC name is [[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]-(2-prop-2-ynoxyethoxycarbonyl)amino] 2,2,2-trifluoroacetate.
| Compound Name | [[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]-(2-prop-2-ynoxyethoxycarbonyl)amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90006453 |
| Molecular Formula | C29H28F3N4O8P |
| Molecular Weight | 648.53 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | [[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]-(2-prop-2-ynoxyethoxycarbonyl)amino] 2,2,2-trifluoroacetate |
| SMILES | C#CCOCCOC(=O)N(OC(=O)C(F)(F)F)C(Cc1ccc(N=C(N)N)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C29H28F3N4O8P/c1-2-17-40-18-19-41-28(38)36(42-26(37)29(30,31)32)25(20-21-13-15-22(16-14-21)35-27(33)34)45(39,43-23-9-5-3-6-10-23)44-24-11-7-4-8-12-24/h1,3-16,25H,17-20H2,(H4,33,34,35) |
| InChIKey | FPCUJXIBCASYSF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 165.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|