C12H14F6N4O4 — CID 22010103
2-[4-(aminomethyl)phenyl]guanidine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 22010103) has the molecular formula C12H14F6N4O4 and a molecular weight of 392.26 g/mol. Its IUPAC name is 2-[4-(aminomethyl)phenyl]guanidine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[4-(aminomethyl)phenyl]guanidine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 22010103 |
| Molecular Formula | C12H14F6N4O4 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[4-(aminomethyl)phenyl]guanidine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCc1ccc(N=C(N)N)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H12N4.2C2HF3O2/c9-5-6-1-3-7(4-2-6)12-8(10)11;2*3-2(4,5)1(6)7/h1-4H,5,9H2,(H4,10,11,12);2*(H,6,7) |
| InChIKey | LSJDCROQPZSAIP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|