C25H32F6N6O4 — CID 159968518
2-[2-[4-[3-[4-[2-(diaminomethylideneamino)ethyl]phenyl]propyl]phenyl]ethyl]guanidine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 159968518) has the molecular formula C25H32F6N6O4 and a molecular weight of 594.56 g/mol. Its IUPAC name is 2-[2-[4-[3-[4-[2-(diaminomethylideneamino)ethyl]phenyl]propyl]phenyl]ethyl]guanidine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[2-[4-[3-[4-[2-(diaminomethylideneamino)ethyl]phenyl]propyl]phenyl]ethyl]guanidine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 159968518 |
| Molecular Formula | C25H32F6N6O4 |
| Molecular Weight | 594.56 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 2-[2-[4-[3-[4-[2-(diaminomethylideneamino)ethyl]phenyl]propyl]phenyl]ethyl]guanidine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(N)=NCCc1ccc(CCCc2ccc(CCN=C(N)N)cc2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H30N6.2C2HF3O2/c22-20(23)26-14-12-18-8-4-16(5-9-18)2-1-3-17-6-10-19(11-7-17)13-15-27-21(24)25;2*3-2(4,5)1(6)7/h4-11H,1-3,12-15H2,(H4,22,23,26)(H4,24,25,27);2*(H,6,7) |
| InChIKey | MYRIFNZIXSXVLT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 203.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|