C9H12FN3 — CID 7176009
2-[2-(4-fluorophenyl)ethyl]guanidine (PubChem CID 7176009) has the molecular formula C9H12FN3 and a molecular weight of 181.21 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]guanidine.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 7176009 |
| Molecular Formula | C9H12FN3 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]guanidine |
| SMILES | NC(N)=NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C9H12FN3/c10-8-3-1-7(2-4-8)5-6-13-9(11)12/h1-4H,5-6H2,(H4,11,12,13) |
| InChIKey | AEMZZSYUUZSWMF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|