C46H58N12O4 — CID 118715677
2-[2-[4-[[2,4,5-tris[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]phenyl]methoxy]phenyl]ethyl]guanidine (PubChem CID 118715677) has the molecular formula C46H58N12O4 and a molecular weight of 843.05 g/mol. Its IUPAC name is 2-[2-[4-[[2,4,5-tris[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]phenyl]methoxy]phenyl]ethyl]guanidine.
| Compound Name | 2-[2-[4-[[2,4,5-tris[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]phenyl]methoxy]phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 118715677 |
| Molecular Formula | C46H58N12O4 |
| Molecular Weight | 843.05 g/mol |
| Exact Mass | 842.47 |
| IUPAC Name | 2-[2-[4-[[2,4,5-tris[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]phenyl]methoxy]phenyl]ethyl]guanidine |
| SMILES | NC(N)=NCCc1ccc(OCc2cc(COc3ccc(CCN=C(N)N)cc3)c(COc3ccc(CCN=C(N)N)cc3)cc2COc2ccc(CCN=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C46H58N12O4/c47-43(48)55-21-17-31-1-9-39(10-2-31)59-27-35-25-37(29-61-41-13-5-33(6-14-41)19-23-57-45(51)52)38(30-62-42-15-7-34(8-16-42)20-24-58-46(53)54)26-36(35)28-60-40-11-3-32(4-12-40)18-22-56-44(49)50/h1-16,25-26H,17-24,27-30H2,(H4,47,48,55)(H4,49,50,56)(H4,51,52,57)(H4,53,54,58) |
| InChIKey | JMFQLDQAJGFEDR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 294.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.05 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|