C23H26IN3O2 — CID 111072146
1-(2-methoxyphenyl)-2-[2-(4-phenylmethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111072146) has the molecular formula C23H26IN3O2 and a molecular weight of 503.38 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-[2-(4-phenylmethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyphenyl)-2-[2-(4-phenylmethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111072146 |
| Molecular Formula | C23H26IN3O2 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-[2-(4-phenylmethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/CCc1ccc(OCc2ccccc2)cc1.I |
| InChI | InChI=1S/C23H25N3O2.HI/c1-27-22-10-6-5-9-21(22)26-23(24)25-16-15-18-11-13-20(14-12-18)28-17-19-7-3-2-4-8-19;/h2-14H,15-17H2,1H3,(H3,24,25,26);1H |
| InChIKey | OAPBFXWOCXPWDJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|