C16H20IN3OS — CID 111033043
1-(2-methoxyphenyl)-2-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111033043) has the molecular formula C16H20IN3OS and a molecular weight of 429.33 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyphenyl)-2-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111033043 |
| Molecular Formula | C16H20IN3OS |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/CCSc1ccccc1.I |
| InChI | InChI=1S/C16H19N3OS.HI/c1-20-15-10-6-5-9-14(15)19-16(17)18-11-12-21-13-7-3-2-4-8-13;/h2-10H,11-12H2,1H3,(H3,17,18,19);1H |
| InChIKey | BKUUGRFSMFSJTF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|