C17H31IN4O — CID 111821758
2-[3-[di(propan-2-yl)amino]propyl]-1-(2-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111821758) has the molecular formula C17H31IN4O and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-[3-[di(propan-2-yl)amino]propyl]-1-(2-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[3-[di(propan-2-yl)amino]propyl]-1-(2-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111821758 |
| Molecular Formula | C17H31IN4O |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[3-[di(propan-2-yl)amino]propyl]-1-(2-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/CCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C17H30N4O.HI/c1-13(2)21(14(3)4)12-8-11-19-17(18)20-15-9-6-7-10-16(15)22-5;/h6-7,9-10,13-14H,8,11-12H2,1-5H3,(H3,18,19,20);1H |
| InChIKey | DUQHSHZGCQIPCL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|