C28H33F3N6O4 — CID 118715671
2-[2-[4-[[3-[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]phenyl]methoxy]phenyl]ethyl]guanidine;2,2,2-trifluoroacetic acid (PubChem CID 118715671) has the molecular formula C28H33F3N6O4 and a molecular weight of 574.60 g/mol. Its IUPAC name is 2-[2-[4-[[3-[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]phenyl]methoxy]phenyl]ethyl]guanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[4-[[3-[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]phenyl]methoxy]phenyl]ethyl]guanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118715671 |
| Molecular Formula | C28H33F3N6O4 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 2-[2-[4-[[3-[[4-[2-(diaminomethylideneamino)ethyl]phenoxy]methyl]phenyl]methoxy]phenyl]ethyl]guanidine;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCc1ccc(OCc2cccc(COc3ccc(CCN=C(N)N)cc3)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H32N6O2.C2HF3O2/c27-25(28)31-14-12-19-4-8-23(9-5-19)33-17-21-2-1-3-22(16-21)18-34-24-10-6-20(7-11-24)13-15-32-26(29)30;3-2(4,5)1(6)7/h1-11,16H,12-15,17-18H2,(H4,27,28,31)(H4,29,30,32);(H,6,7) |
| InChIKey | HDIOEVVYIQNCKG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 184.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|