C16H16FNO3 — CID 11687874
2-[4-[(3-fluorophenyl)methoxy]phenyl]ethyl carbamate (PubChem CID 11687874) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[4-[(3-fluorophenyl)methoxy]phenyl]ethyl carbamate.
| Compound Name | 2-[4-[(3-fluorophenyl)methoxy]phenyl]ethyl carbamate |
|---|---|
| PubChem CID | 11687874 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[4-[(3-fluorophenyl)methoxy]phenyl]ethyl carbamate |
| SMILES | NC(=O)OCCc1ccc(OCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C16H16FNO3/c17-14-3-1-2-13(10-14)11-21-15-6-4-12(5-7-15)8-9-20-16(18)19/h1-7,10H,8-9,11H2,(H2,18,19) |
| InChIKey | QPRGKUZTYXRGLE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |