C16H16FNO4 — CID 171869350
3-[4-[(3-fluorophenyl)methoxy]phenyl]-2,3-dihydroxypropanamide (PubChem CID 171869350) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-[4-[(3-fluorophenyl)methoxy]phenyl]-2,3-dihydroxypropanamide.
| Compound Name | 3-[4-[(3-fluorophenyl)methoxy]phenyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869350 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3-[4-[(3-fluorophenyl)methoxy]phenyl]-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc(OCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C16H16FNO4/c17-12-3-1-2-10(8-12)9-22-13-6-4-11(5-7-13)14(19)15(20)16(18)21/h1-8,14-15,19-20H,9H2,(H2,18,21) |
| InChIKey | WXQJVLANRALJSE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |