C25H24F3NO4 — CID 123258613
3-[4-(4-phenylbutoxy)phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 123258613) has the molecular formula C25H24F3NO4 and a molecular weight of 459.46 g/mol. Its IUPAC name is 3-[4-(4-phenylbutoxy)phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-(4-phenylbutoxy)phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 123258613 |
| Molecular Formula | C25H24F3NO4 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 3-[4-(4-phenylbutoxy)phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cccc(-c2ccc(OCCCCc3ccccc3)cc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H23NO2.C2HF3O2/c24-23(25)21-11-6-10-20(17-21)19-12-14-22(15-13-19)26-16-5-4-9-18-7-2-1-3-8-18;3-2(4,5)1(6)7/h1-3,6-8,10-15,17H,4-5,9,16H2,(H2,24,25);(H,6,7) |
| InChIKey | ORIMAUQTCQPVJS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|