C20H23F3N2O5 — CID 143629604
3-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 143629604) has the molecular formula C20H23F3N2O5 and a molecular weight of 428.41 g/mol. Its IUPAC name is 3-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143629604 |
| Molecular Formula | C20H23F3N2O5 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNCCOc1ccc(-c2cccc(C(N)=O)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N2O3.C2HF3O2/c1-22-11-9-20-10-12-23-17-7-5-14(6-8-17)15-3-2-4-16(13-15)18(19)21;3-2(4,5)1(6)7/h2-8,13,20H,9-12H2,1H3,(H2,19,21);(H,6,7) |
| InChIKey | POZGIWKDMSSJQB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|