C23H23FN2O2 — CID 58276651
3-[4-[2-[2-(3-fluorophenyl)ethylamino]ethoxy]phenyl]benzamide (PubChem CID 58276651) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-[4-[2-[2-(3-fluorophenyl)ethylamino]ethoxy]phenyl]benzamide.
| Compound Name | 3-[4-[2-[2-(3-fluorophenyl)ethylamino]ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 58276651 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-[4-[2-[2-(3-fluorophenyl)ethylamino]ethoxy]phenyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(OCCNCCc3cccc(F)c3)cc2)c1 |
| InChI | InChI=1S/C23H23FN2O2/c24-21-6-1-3-17(15-21)11-12-26-13-14-28-22-9-7-18(8-10-22)19-4-2-5-20(16-19)23(25)27/h1-10,15-16,26H,11-14H2,(H2,25,27) |
| InChIKey | KIFVPWAFQNLNIF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|