C24H21F5N2O4 — CID 143629555
3-[4-[2-[(3,5-difluorophenyl)methylamino]ethoxy]phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 143629555) has the molecular formula C24H21F5N2O4 and a molecular weight of 496.43 g/mol. Its IUPAC name is 3-[4-[2-[(3,5-difluorophenyl)methylamino]ethoxy]phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[2-[(3,5-difluorophenyl)methylamino]ethoxy]phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143629555 |
| Molecular Formula | C24H21F5N2O4 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 3-[4-[2-[(3,5-difluorophenyl)methylamino]ethoxy]phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cccc(-c2ccc(OCCNCc3cc(F)cc(F)c3)cc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H20F2N2O2.C2HF3O2/c23-19-10-15(11-20(24)13-19)14-26-8-9-28-21-6-4-16(5-7-21)17-2-1-3-18(12-17)22(25)27;3-2(4,5)1(6)7/h1-7,10-13,26H,8-9,14H2,(H2,25,27);(H,6,7) |
| InChIKey | BONPCWSHTQHLRD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|