C22H23ClFN3O2 — CID 67163111
5-[4-[2-[2-(3-fluorophenyl)ethylamino]ethoxy]phenyl]pyridine-3-carboxamide;hydrochloride (PubChem CID 67163111) has the molecular formula C22H23ClFN3O2 and a molecular weight of 415.90 g/mol. Its IUPAC name is 5-[4-[2-[2-(3-fluorophenyl)ethylamino]ethoxy]phenyl]pyridine-3-carboxamide;hydrochloride.
| Compound Name | 5-[4-[2-[2-(3-fluorophenyl)ethylamino]ethoxy]phenyl]pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67163111 |
| Molecular Formula | C22H23ClFN3O2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-[4-[2-[2-(3-fluorophenyl)ethylamino]ethoxy]phenyl]pyridine-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cncc(-c2ccc(OCCNCCc3cccc(F)c3)cc2)c1 |
| InChI | InChI=1S/C22H22FN3O2.ClH/c23-20-3-1-2-16(12-20)8-9-25-10-11-28-21-6-4-17(5-7-21)18-13-19(22(24)27)15-26-14-18;/h1-7,12-15,25H,8-11H2,(H2,24,27);1H |
| InChIKey | QEWDMRICOHCMEL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|