C20H19FN2O2 — CID 159549428
N-[(3-fluorophenyl)methyl]-5-(4-hydroxyphenyl)pyridine-3-carboxamide;methane (PubChem CID 159549428) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-5-(4-hydroxyphenyl)pyridine-3-carboxamide;methane.
| Compound Name | N-[(3-fluorophenyl)methyl]-5-(4-hydroxyphenyl)pyridine-3-carboxamide;methane |
|---|---|
| PubChem CID | 159549428 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-5-(4-hydroxyphenyl)pyridine-3-carboxamide;methane |
| SMILES | C.O=C(NCc1cccc(F)c1)c1cncc(-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C19H15FN2O2.CH4/c20-17-3-1-2-13(8-17)10-22-19(24)16-9-15(11-21-12-16)14-4-6-18(23)7-5-14;/h1-9,11-12,23H,10H2,(H,22,24);1H4 |
| InChIKey | MFFACZPQPVBRTK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |