C19H15FN2O — CID 42845762
N-benzyl-5-(3-fluorophenyl)pyridine-3-carboxamide (PubChem CID 42845762) has the molecular formula C19H15FN2O and a molecular weight of 306.34 g/mol. Its IUPAC name is N-benzyl-5-(3-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | N-benzyl-5-(3-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42845762 |
| Molecular Formula | C19H15FN2O |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-benzyl-5-(3-fluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cncc(-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H15FN2O/c20-18-8-4-7-15(10-18)16-9-17(13-21-12-16)19(23)22-11-14-5-2-1-3-6-14/h1-10,12-13H,11H2,(H,22,23) |
| InChIKey | GZQSFRWWCZDIEY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |