C19H14ClFN2O — CID 46032155
5-(2-chlorophenyl)-N-[(4-fluorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 46032155) has the molecular formula C19H14ClFN2O and a molecular weight of 340.79 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[(4-fluorophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-[(4-fluorophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46032155 |
| Molecular Formula | C19H14ClFN2O |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[(4-fluorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cncc(-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H14ClFN2O/c20-18-4-2-1-3-17(18)14-9-15(12-22-11-14)19(24)23-10-13-5-7-16(21)8-6-13/h1-9,11-12H,10H2,(H,23,24) |
| InChIKey | NALYWKGWIDKMAJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |