C26H21FN2O3S — CID 46386301
N-benzyl-4-[[4-(3-fluorophenyl)phenyl]sulfonylamino]benzamide (PubChem CID 46386301) has the molecular formula C26H21FN2O3S and a molecular weight of 460.53 g/mol. Its IUPAC name is N-benzyl-4-[[4-(3-fluorophenyl)phenyl]sulfonylamino]benzamide.
| Compound Name | N-benzyl-4-[[4-(3-fluorophenyl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 46386301 |
| Molecular Formula | C26H21FN2O3S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-benzyl-4-[[4-(3-fluorophenyl)phenyl]sulfonylamino]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(NS(=O)(=O)c2ccc(-c3cccc(F)c3)cc2)cc1 |
| InChI | InChI=1S/C26H21FN2O3S/c27-23-8-4-7-22(17-23)20-11-15-25(16-12-20)33(31,32)29-24-13-9-21(10-14-24)26(30)28-18-19-5-2-1-3-6-19/h1-17,29H,18H2,(H,28,30) |
| InChIKey | OOILGGZAKZFUIK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |