C19H15F2N3O3S — CID 36900818
N-[(3,5-difluorophenyl)methyl]-4-(pyridin-4-ylsulfamoyl)benzamide (PubChem CID 36900818) has the molecular formula C19H15F2N3O3S and a molecular weight of 403.41 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-4-(pyridin-4-ylsulfamoyl)benzamide.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-4-(pyridin-4-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 36900818 |
| Molecular Formula | C19H15F2N3O3S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-4-(pyridin-4-ylsulfamoyl)benzamide |
| SMILES | O=C(NCc1cc(F)cc(F)c1)c1ccc(S(=O)(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C19H15F2N3O3S/c20-15-9-13(10-16(21)11-15)12-23-19(25)14-1-3-18(4-2-14)28(26,27)24-17-5-7-22-8-6-17/h1-11H,12H2,(H,22,24)(H,23,25) |
| InChIKey | MZZAMLFNGKDRRI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |