C24H24FNO2 — CID 58276440
4-[4-[5-(3-fluorophenyl)pentoxy]phenyl]benzamide (PubChem CID 58276440) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-[4-[5-(3-fluorophenyl)pentoxy]phenyl]benzamide.
| Compound Name | 4-[4-[5-(3-fluorophenyl)pentoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 58276440 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-[4-[5-(3-fluorophenyl)pentoxy]phenyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(OCCCCCc3cccc(F)c3)cc2)cc1 |
| InChI | InChI=1S/C24H24FNO2/c25-22-7-4-6-18(17-22)5-2-1-3-16-28-23-14-12-20(13-15-23)19-8-10-21(11-9-19)24(26)27/h4,6-15,17H,1-3,5,16H2,(H2,26,27) |
| InChIKey | XNJUWVMOHPEYQN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|