C20H20N2O2S — CID 59316398
3-[4-[2-(thiophen-2-ylmethylamino)ethoxy]phenyl]benzamide (PubChem CID 59316398) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-[4-[2-(thiophen-2-ylmethylamino)ethoxy]phenyl]benzamide.
| Compound Name | 3-[4-[2-(thiophen-2-ylmethylamino)ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 59316398 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-[4-[2-(thiophen-2-ylmethylamino)ethoxy]phenyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(OCCNCc3cccs3)cc2)c1 |
| InChI | InChI=1S/C20H20N2O2S/c21-20(23)17-4-1-3-16(13-17)15-6-8-18(9-7-15)24-11-10-22-14-19-5-2-12-25-19/h1-9,12-13,22H,10-11,14H2,(H2,21,23) |
| InChIKey | CCHDBKPWUKIGRX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|