C25H32N2O2 — CID 71125468
3-[4-[2-[[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]ethoxy]phenyl]benzamide (PubChem CID 71125468) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-[4-[2-[[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]ethoxy]phenyl]benzamide.
| Compound Name | 3-[4-[2-[[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 71125468 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 3-[4-[2-[[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]ethoxy]phenyl]benzamide |
| SMILES | C[C@@H]1C(NCCOc2ccc(-c3cccc(C(N)=O)c3)cc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C25H32N2O2/c1-16-22-14-20(25(22,2)3)15-23(16)27-11-12-29-21-9-7-17(8-10-21)18-5-4-6-19(13-18)24(26)28/h4-10,13,16,20,22-23,27H,11-12,14-15H2,1-3H3,(H2,26,28)/t16-,20+,22-,23?/m0/s1 |
| InChIKey | ZGHHJXVBHXVXCN-FNTBWRLESA-N |
| XLogP | 4.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|