C23H27NO2 — CID 67389104
4-[4-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]benzoic acid (PubChem CID 67389104) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 4-[4-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]benzoic acid.
| Compound Name | 4-[4-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67389104 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 4-[4-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]benzoic acid |
| SMILES | C[C@@H]1[C@@H](Nc2ccc(-c3ccc(C(=O)O)cc3)cc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C23H27NO2/c1-14-20-12-18(23(20,2)3)13-21(14)24-19-10-8-16(9-11-19)15-4-6-17(7-5-15)22(25)26/h4-11,14,18,20-21,24H,12-13H2,1-3H3,(H,25,26)/t14-,18+,20-,21-/m0/s1 |
| InChIKey | JLZOKQXDTKJUCY-KGSNELEXSA-N |
| XLogP | 5.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |