C11H20N2O — CID 130949408
[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]urea (PubChem CID 130949408) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is [(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]urea.
| Compound Name | [(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]urea |
|---|---|
| PubChem CID | 130949408 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]urea |
| SMILES | C[C@@H]1[C@@H](NC(N)=O)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C11H20N2O/c1-6-8-4-7(11(8,2)3)5-9(6)13-10(12)14/h6-9H,4-5H2,1-3H3,(H3,12,13,14)/t6-,7-,8+,9-/m0/s1 |
| InChIKey | NGKIEQQIXBFTHF-MAUMQABQSA-N |
| XLogP | 1.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |