C19H28N2O — CID 44759786
1-[(1S)-1-phenylethyl]-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]urea (PubChem CID 44759786) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-[(1S)-1-phenylethyl]-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]urea.
| Compound Name | 1-[(1S)-1-phenylethyl]-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]urea |
|---|---|
| PubChem CID | 44759786 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 1-[(1S)-1-phenylethyl]-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]urea |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1NC(=O)N[C@@H](C)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C19H28N2O/c1-12-16-10-15(19(16,3)4)11-17(12)21-18(22)20-13(2)14-8-6-5-7-9-14/h5-9,12-13,15-17H,10-11H2,1-4H3,(H2,20,21,22)/t12-,13+,15+,16-,17-/m1/s1 |
| InChIKey | XFAPUSRZBMELCQ-PNDGYWDASA-N |
| XLogP | 4.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |