C21H24N2O — CID 10381354
1-[(1R,2R,5S)-2-phenyl-2-bicyclo[3.1.0]hexanyl]-3-[(1S)-1-phenylethyl]urea (PubChem CID 10381354) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-[(1R,2R,5S)-2-phenyl-2-bicyclo[3.1.0]hexanyl]-3-[(1S)-1-phenylethyl]urea.
| Compound Name | 1-[(1R,2R,5S)-2-phenyl-2-bicyclo[3.1.0]hexanyl]-3-[(1S)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 10381354 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-[(1R,2R,5S)-2-phenyl-2-bicyclo[3.1.0]hexanyl]-3-[(1S)-1-phenylethyl]urea |
| SMILES | C[C@H](NC(=O)N[C@]1(c2ccccc2)CC[C@H]2C[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O/c1-15(16-8-4-2-5-9-16)22-20(24)23-21(13-12-17-14-19(17)21)18-10-6-3-7-11-18/h2-11,15,17,19H,12-14H2,1H3,(H2,22,23,24)/t15-,17-,19+,21-/m0/s1 |
| InChIKey | TUMNWRICLMROPS-OQKHSGFDSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |