C28H32N2O — CID 141030171
1-[(4-cyclohexylphenyl)-phenylmethyl]-3-[(1R)-1-phenylethyl]urea (PubChem CID 141030171) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-[(4-cyclohexylphenyl)-phenylmethyl]-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-[(4-cyclohexylphenyl)-phenylmethyl]-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 141030171 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1-[(4-cyclohexylphenyl)-phenylmethyl]-3-[(1R)-1-phenylethyl]urea |
| SMILES | C[C@@H](NC(=O)NC(c1ccccc1)c1ccc(C2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O/c1-21(22-11-5-2-6-12-22)29-28(31)30-27(25-15-9-4-10-16-25)26-19-17-24(18-20-26)23-13-7-3-8-14-23/h2,4-6,9-12,15-21,23,27H,3,7-8,13-14H2,1H3,(H2,29,30,31)/t21-,27?/m1/s1 |
| InChIKey | SPZOKLVSVZRMQL-XJQHNOHDSA-N |
| XLogP | 6.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |