C27H30N2O3S — CID 141030160
1-[(4-cyclohexylphenyl)-phenylmethyl]-3-(3-methylsulfonylphenyl)urea (PubChem CID 141030160) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is 1-[(4-cyclohexylphenyl)-phenylmethyl]-3-(3-methylsulfonylphenyl)urea.
| Compound Name | 1-[(4-cyclohexylphenyl)-phenylmethyl]-3-(3-methylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 141030160 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1-[(4-cyclohexylphenyl)-phenylmethyl]-3-(3-methylsulfonylphenyl)urea |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)NC(c2ccccc2)c2ccc(C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C27H30N2O3S/c1-33(31,32)25-14-8-13-24(19-25)28-27(30)29-26(22-11-6-3-7-12-22)23-17-15-21(16-18-23)20-9-4-2-5-10-20/h3,6-8,11-20,26H,2,4-5,9-10H2,1H3,(H2,28,29,30) |
| InChIKey | ZETAUAIPQZMXOS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |