C30H32IN3O4 — CID 20636975
3-[[4-[(4-cyclohexylphenyl)-[(3-iodophenyl)carbamoylamino]methyl]benzoyl]amino]propanoic acid (PubChem CID 20636975) has the molecular formula C30H32IN3O4 and a molecular weight of 625.51 g/mol. Its IUPAC name is 3-[[4-[(4-cyclohexylphenyl)-[(3-iodophenyl)carbamoylamino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(4-cyclohexylphenyl)-[(3-iodophenyl)carbamoylamino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20636975 |
| Molecular Formula | C30H32IN3O4 |
| Molecular Weight | 625.51 g/mol |
| Exact Mass | 625.14 |
| IUPAC Name | 3-[[4-[(4-cyclohexylphenyl)-[(3-iodophenyl)carbamoylamino]methyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(C(NC(=O)Nc2cccc(I)c2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H32IN3O4/c31-25-7-4-8-26(19-25)33-30(38)34-28(22-11-9-21(10-12-22)20-5-2-1-3-6-20)23-13-15-24(16-14-23)29(37)32-18-17-27(35)36/h4,7-16,19-20,28H,1-3,5-6,17-18H2,(H,32,37)(H,35,36)(H2,33,34,38) |
| InChIKey | UTRTWPJFHLRFMZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.51 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|