C31H34N2O4 — CID 20742322
3-[[4-[3-anilino-2-(4-cyclohexylphenyl)-3-oxopropyl]benzoyl]amino]propanoic acid (PubChem CID 20742322) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is 3-[[4-[3-anilino-2-(4-cyclohexylphenyl)-3-oxopropyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-anilino-2-(4-cyclohexylphenyl)-3-oxopropyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20742322 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 3-[[4-[3-anilino-2-(4-cyclohexylphenyl)-3-oxopropyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CC(C(=O)Nc2ccccc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H34N2O4/c34-29(35)19-20-32-30(36)26-13-11-22(12-14-26)21-28(31(37)33-27-9-5-2-6-10-27)25-17-15-24(16-18-25)23-7-3-1-4-8-23/h2,5-6,9-18,23,28H,1,3-4,7-8,19-21H2,(H,32,36)(H,33,37)(H,34,35) |
| InChIKey | RSKAIKGEBYSXAD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |