C24H27ClN2O4 — CID 91074681
3-[[4-[[2-chloro-1-(4-cyclohexylphenyl)-2-oxoethyl]amino]benzoyl]amino]propanoic acid (PubChem CID 91074681) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is 3-[[4-[[2-chloro-1-(4-cyclohexylphenyl)-2-oxoethyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[2-chloro-1-(4-cyclohexylphenyl)-2-oxoethyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 91074681 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[[4-[[2-chloro-1-(4-cyclohexylphenyl)-2-oxoethyl]amino]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(NC(C(=O)Cl)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H27ClN2O4/c25-23(30)22(18-8-6-17(7-9-18)16-4-2-1-3-5-16)27-20-12-10-19(11-13-20)24(31)26-15-14-21(28)29/h6-13,16,22,27H,1-5,14-15H2,(H,26,31)(H,28,29) |
| InChIKey | WKIZATLZVRTTRX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|