C37H39NO5 — CID 87416951
3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-(4-cyclopentylphenyl)-4-oxobut-2-enoyl]benzoyl]amino]propanoic acid (PubChem CID 87416951) has the molecular formula C37H39NO5 and a molecular weight of 577.72 g/mol. Its IUPAC name is 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-(4-cyclopentylphenyl)-4-oxobut-2-enoyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-(4-cyclopentylphenyl)-4-oxobut-2-enoyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87416951 |
| Molecular Formula | C37H39NO5 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-(4-cyclopentylphenyl)-4-oxobut-2-enoyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(C(=O)/C(=C/C(=O)c2ccc(C3CCCC3)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C37H39NO5/c39-34(30-16-12-28(13-17-30)26-8-4-5-9-26)24-33(29-14-10-27(11-15-29)25-6-2-1-3-7-25)36(42)31-18-20-32(21-19-31)37(43)38-23-22-35(40)41/h10-21,24-26H,1-9,22-23H2,(H,38,43)(H,40,41)/b33-24+ |
| InChIKey | QMLFFUOTPNEXHX-IWBSIUBASA-N |
| XLogP | 7.75 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|