C36H39NO5 — CID 23508896
3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-[4-(2-methylpropyl)phenyl]-4-oxobut-2-enoyl]benzoyl]amino]propanoic acid (PubChem CID 23508896) has the molecular formula C36H39NO5 and a molecular weight of 565.71 g/mol. Its IUPAC name is 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-[4-(2-methylpropyl)phenyl]-4-oxobut-2-enoyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-[4-(2-methylpropyl)phenyl]-4-oxobut-2-enoyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23508896 |
| Molecular Formula | C36H39NO5 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-[4-(2-methylpropyl)phenyl]-4-oxobut-2-enoyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)Cc1ccc(C(=O)/C=C(/C(=O)c2ccc(C(=O)NCCC(=O)O)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C36H39NO5/c1-24(2)22-25-8-10-29(11-9-25)33(38)23-32(28-14-12-27(13-15-28)26-6-4-3-5-7-26)35(41)30-16-18-31(19-17-30)36(42)37-21-20-34(39)40/h8-19,23-24,26H,3-7,20-22H2,1-2H3,(H,37,42)(H,39,40)/b32-23+ |
| InChIKey | KVQYYRNBVZZDQI-AWSUPERCSA-N |
| XLogP | 7.29 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|