C33H30F3NO5S — CID 20742335
3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-oxo-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid (PubChem CID 20742335) has the molecular formula C33H30F3NO5S and a molecular weight of 609.67 g/mol. Its IUPAC name is 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-oxo-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-oxo-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20742335 |
| Molecular Formula | C33H30F3NO5S |
| Molecular Weight | 609.67 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 3-[[4-[(E)-2-(4-cyclohexylphenyl)-4-oxo-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(C(=O)/C(=C/C(=O)c2cccc(SC(F)(F)F)c2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C33H30F3NO5S/c34-33(35,36)43-27-8-4-7-26(19-27)29(38)20-28(23-11-9-22(10-12-23)21-5-2-1-3-6-21)31(41)24-13-15-25(16-14-24)32(42)37-18-17-30(39)40/h4,7-16,19-21H,1-3,5-6,17-18H2,(H,37,42)(H,39,40)/b28-20+ |
| InChIKey | OGJBGNSDCCWDRH-VFCFBJKWSA-N |
| XLogP | 7.70 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|