C30H22F3NO6S — CID 142248256
3-[[4-[(Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-oxo-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoyl]benzoyl]amino]-2-oxopropanoic acid (PubChem CID 142248256) has the molecular formula C30H22F3NO6S and a molecular weight of 581.57 g/mol. Its IUPAC name is 3-[[4-[(Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-oxo-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoyl]benzoyl]amino]-2-oxopropanoic acid.
| Compound Name | 3-[[4-[(Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-oxo-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoyl]benzoyl]amino]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 142248256 |
| Molecular Formula | C30H22F3NO6S |
| Molecular Weight | 581.57 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 3-[[4-[(Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-oxo-4-[3-(trifluoromethylsulfanyl)phenyl]but-2-enoyl]benzoyl]amino]-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)CNC(=O)c1ccc(C(=O)/C(=C\C(=O)c2cccc(SC(F)(F)F)c2)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C30H22F3NO6S/c31-30(32,33)41-23-6-2-5-22(14-23)25(35)15-24(21-12-7-17-3-1-4-20(17)13-21)27(37)18-8-10-19(11-9-18)28(38)34-16-26(36)29(39)40/h2,5-15H,1,3-4,16H2,(H,34,38)(H,39,40)/b24-15- |
| InChIKey | CAVOTQYMCZTUII-IWIPYMOSSA-N |
| XLogP | 5.32 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|