C28H19F6NO7 — CID 59125636
3-[[4-[(Z)-4-oxo-4-[3-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethoxy)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid (PubChem CID 59125636) has the molecular formula C28H19F6NO7 and a molecular weight of 595.45 g/mol. Its IUPAC name is 3-[[4-[(Z)-4-oxo-4-[3-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethoxy)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(Z)-4-oxo-4-[3-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethoxy)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59125636 |
| Molecular Formula | C28H19F6NO7 |
| Molecular Weight | 595.45 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | 3-[[4-[(Z)-4-oxo-4-[3-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethoxy)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(C(=O)/C(=C\C(=O)c2cccc(OC(F)(F)F)c2)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H19F6NO7/c29-27(30,31)41-20-10-8-16(9-11-20)22(15-23(36)19-2-1-3-21(14-19)42-28(32,33)34)25(39)17-4-6-18(7-5-17)26(40)35-13-12-24(37)38/h1-11,14-15H,12-13H2,(H,35,40)(H,37,38)/b22-15- |
| InChIKey | ZIQYVWLVEWOIEQ-JCMHNJIXSA-N |
| XLogP | 5.84 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|