C20H19F3N2O4 — CID 142256739
3-[[4-methyl-3-[1-[3-(trifluoromethoxy)phenyl]ethylideneamino]benzoyl]amino]propanoic acid (PubChem CID 142256739) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 3-[[4-methyl-3-[1-[3-(trifluoromethoxy)phenyl]ethylideneamino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-methyl-3-[1-[3-(trifluoromethoxy)phenyl]ethylideneamino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142256739 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-[[4-methyl-3-[1-[3-(trifluoromethoxy)phenyl]ethylideneamino]benzoyl]amino]propanoic acid |
| SMILES | C/C(=N\c1cc(C(=O)NCCC(=O)O)ccc1C)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-12-6-7-15(19(28)24-9-8-18(26)27)11-17(12)25-13(2)14-4-3-5-16(10-14)29-20(21,22)23/h3-7,10-11H,8-9H2,1-2H3,(H,24,28)(H,26,27)/b25-13+ |
| InChIKey | RUBRSLMDJGNGOU-DHRITJCHSA-N |
| XLogP | 4.24 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|