C26H23F3N2O4 — CID 142256753
3-[[4-methyl-3-[1-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethylideneamino]benzoyl]amino]propanoic acid (PubChem CID 142256753) has the molecular formula C26H23F3N2O4 and a molecular weight of 484.47 g/mol. Its IUPAC name is 3-[[4-methyl-3-[1-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethylideneamino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-methyl-3-[1-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethylideneamino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142256753 |
| Molecular Formula | C26H23F3N2O4 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 3-[[4-methyl-3-[1-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethylideneamino]benzoyl]amino]propanoic acid |
| SMILES | C/C(=N\c1cc(C(=O)NCCC(=O)O)ccc1C)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H23F3N2O4/c1-16-9-10-19(25(34)30-12-11-24(32)33)14-23(16)31-17(2)18-5-3-7-21(13-18)35-22-8-4-6-20(15-22)26(27,28)29/h3-10,13-15H,11-12H2,1-2H3,(H,30,34)(H,32,33)/b31-17+ |
| InChIKey | DYHOWMHYCNGXOA-KBVAKVRCSA-N |
| XLogP | 6.15 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|