C30H29F3N2O5 — CID 23508844
3-[[4-[(E)-3-(4-tert-butylanilino)-3-oxo-2-[4-(trifluoromethoxy)phenyl]prop-1-enyl]benzoyl]amino]propanoic acid (PubChem CID 23508844) has the molecular formula C30H29F3N2O5 and a molecular weight of 554.57 g/mol. Its IUPAC name is 3-[[4-[(E)-3-(4-tert-butylanilino)-3-oxo-2-[4-(trifluoromethoxy)phenyl]prop-1-enyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(E)-3-(4-tert-butylanilino)-3-oxo-2-[4-(trifluoromethoxy)phenyl]prop-1-enyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23508844 |
| Molecular Formula | C30H29F3N2O5 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 3-[[4-[(E)-3-(4-tert-butylanilino)-3-oxo-2-[4-(trifluoromethoxy)phenyl]prop-1-enyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)c1ccc(NC(=O)/C(=C/c2ccc(C(=O)NCCC(=O)O)cc2)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H29F3N2O5/c1-29(2,3)22-10-12-23(13-11-22)35-28(39)25(20-8-14-24(15-9-20)40-30(31,32)33)18-19-4-6-21(7-5-19)27(38)34-17-16-26(36)37/h4-15,18H,16-17H2,1-3H3,(H,34,38)(H,35,39)(H,36,37)/b25-18+ |
| InChIKey | DYJQMELSFPWQFZ-XIEYBQDHSA-N |
| XLogP | 6.27 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|