C29H31F3N2O6S — CID 88866806
2-[[4-[2-(4-tert-butylphenyl)-3-oxo-3-[4-(trifluoromethoxy)anilino]propyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866806) has the molecular formula C29H31F3N2O6S and a molecular weight of 592.64 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-3-oxo-3-[4-(trifluoromethoxy)anilino]propyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-3-oxo-3-[4-(trifluoromethoxy)anilino]propyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866806 |
| Molecular Formula | C29H31F3N2O6S |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-3-oxo-3-[4-(trifluoromethoxy)anilino]propyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)C(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H31F3N2O6S/c1-28(2,3)22-10-8-20(9-11-22)25(27(36)34-23-12-14-24(15-13-23)40-29(30,31)32)18-19-4-6-21(7-5-19)26(35)33-16-17-41(37,38)39/h4-15,25H,16-18H2,1-3H3,(H,33,35)(H,34,36)(H,37,38,39) |
| InChIKey | CMASKOOKQKPIQA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|