C36H37N3O5S — CID 88866888
2-[[4-[2-(4-tert-butylphenyl)-3-[4-[4-(cyanomethyl)phenyl]anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866888) has the molecular formula C36H37N3O5S and a molecular weight of 623.77 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-3-[4-[4-(cyanomethyl)phenyl]anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-3-[4-[4-(cyanomethyl)phenyl]anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866888 |
| Molecular Formula | C36H37N3O5S |
| Molecular Weight | 623.77 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-3-[4-[4-(cyanomethyl)phenyl]anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)C(=O)Nc2ccc(-c3ccc(CC#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H37N3O5S/c1-36(2,3)31-16-12-29(13-17-31)33(24-26-6-10-30(11-7-26)34(40)38-22-23-45(42,43)44)35(41)39-32-18-14-28(15-19-32)27-8-4-25(5-9-27)20-21-37/h4-19,33H,20,22-24H2,1-3H3,(H,38,40)(H,39,41)(H,42,43,44) |
| InChIKey | FJOGOSGUXPHMIS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.77 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|